C33H32N4Pt — CID 59645808
CID 59645808 (PubChem CID 59645808) has the molecular formula C33H32N4Pt and a molecular weight of 679.73 g/mol.
| Compound Name | CID 59645808 |
|---|---|
| PubChem CID | 59645808 |
| Molecular Formula | C33H32N4Pt |
| Molecular Weight | 679.73 g/mol |
| Exact Mass | 679.23 |
| IUPAC Name | — |
| SMILES | Cc1cc2nn1C(C)(C)n1nc(cc1C)-c1[c-]c(cc(C(C)(C)C)c1)-c1cccc(c1)-c1[c-]c-2ccc1.[Pt+2] |
| InChI | InChI=1S/C33H32N4.Pt/c1-21-14-30-26-13-9-11-24(17-26)23-10-8-12-25(16-23)27-18-28(20-29(19-27)32(3,4)5)31-15-22(2)37(35-31)33(6,7)36(21)34-30;/h8-16,19-20H,1-7H3;/q-2;+2 |
| InChIKey | CCYWSSFNQQPZPI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.73 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|