C28H46N3O2+ — CID 59670595
(5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-(1H-imidazol-1-ium-1-yl)-16,16-dimethylicosa-5,8,11,14-tetraenamide (PubChem CID 59670595) has the molecular formula C28H46N3O2+ and a molecular weight of 456.70 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-(1H-imidazol-1-ium-1-yl)-16,16-dimethylicosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-(1H-imidazol-1-ium-1-yl)-16,16-dimethylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 59670595 |
| Molecular Formula | C28H46N3O2+ |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[(2R)-1-hydroxypropan-2-yl]-20-(1H-imidazol-1-ium-1-yl)-16,16-dimethylicosa-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C(C)(C)CCCC[NH+]1C=CN=C1 |
| InChI | InChI=1S/C28H45N3O2/c1-26(24-32)30-27(33)18-14-12-10-8-6-4-5-7-9-11-13-15-19-28(2,3)20-16-17-22-31-23-21-29-25-31/h4-5,8-11,15,19,21,23,25-26,32H,6-7,12-14,16-18,20,22,24H2,1-3H3,(H,30,33)/p+1/b5-4-,10-8-,11-9-,19-15-/t26-/m1/s1 |
| InChIKey | PXVAYIZPZAGOEB-COVGAHQNSA-O |
| XLogP | 4.64 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|