C9H12N2O2 — CID 59686819
(1S,3Z,6S)-7-methyl-7,9-diazabicyclo[4.2.2]dec-3-ene-8,10-dione (PubChem CID 59686819) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (1S,3Z,6S)-7-methyl-7,9-diazabicyclo[4.2.2]dec-3-ene-8,10-dione.
| Compound Name | (1S,3Z,6S)-7-methyl-7,9-diazabicyclo[4.2.2]dec-3-ene-8,10-dione |
|---|---|
| PubChem CID | 59686819 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (1S,3Z,6S)-7-methyl-7,9-diazabicyclo[4.2.2]dec-3-ene-8,10-dione |
| SMILES | CN1C(=O)[C@@H]2C/C=C\C[C@H]1C(=O)N2 |
| InChI | InChI=1S/C9H12N2O2/c1-11-7-5-3-2-4-6(9(11)13)10-8(7)12/h2-3,6-7H,4-5H2,1H3,(H,10,12)/b3-2-/t6-,7-/m0/s1 |
| InChIKey | CDIYYABMYRPIPX-QNNCNFPFSA-N |
| XLogP | -0.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|