C12H12F14O3 — CID 59689356
4,5,5,5-tetrafluoro-1-[4,5,5,5-tetrafluoro-2-hydroxy-4-(trifluoromethyl)pentoxy]-4-(trifluoromethyl)pentan-2-ol (PubChem CID 59689356) has the molecular formula C12H12F14O3 and a molecular weight of 470.20 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-1-[4,5,5,5-tetrafluoro-2-hydroxy-4-(trifluoromethyl)pentoxy]-4-(trifluoromethyl)pentan-2-ol.
| Compound Name | 4,5,5,5-tetrafluoro-1-[4,5,5,5-tetrafluoro-2-hydroxy-4-(trifluoromethyl)pentoxy]-4-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 59689356 |
| Molecular Formula | C12H12F14O3 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 4,5,5,5-tetrafluoro-1-[4,5,5,5-tetrafluoro-2-hydroxy-4-(trifluoromethyl)pentoxy]-4-(trifluoromethyl)pentan-2-ol |
| SMILES | OC(COCC(O)CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F14O3/c13-7(9(15,16)17,10(18,19)20)1-5(27)3-29-4-6(28)2-8(14,11(21,22)23)12(24,25)26/h5-6,27-28H,1-4H2 |
| InChIKey | RQRMGXXXSACPHX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |