C25H32N4O5 — CID 59697006
N-[(2S,3R)-1-[2-[cyclopropylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide (PubChem CID 59697006) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[(2S,3R)-1-[2-[cyclopropylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide.
| Compound Name | N-[(2S,3R)-1-[2-[cyclopropylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide |
|---|---|
| PubChem CID | 59697006 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[(2S,3R)-1-[2-[cyclopropylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide |
| SMILES | CCc1ccc(-c2ccc(C(=O)N[C@H](C(=O)NCCN(O)C(=O)NC3CC3)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O5/c1-3-17-4-6-18(7-5-17)19-8-10-20(11-9-19)23(31)28-22(16(2)30)24(32)26-14-15-29(34)25(33)27-21-12-13-21/h4-11,16,21-22,30,34H,3,12-15H2,1-2H3,(H,26,32)(H,27,33)(H,28,31)/t16-,22+/m1/s1 |
| InChIKey | QGSMGHQFDCSBGZ-ZHRRBRCNSA-N |
| XLogP | 2.07 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|