C23H29N3O4S — CID 58342801
N-[(2R,3S)-7-[carbamothioyl(hydroxy)amino]-2-hydroxy-4-oxoheptan-3-yl]-4-(4-ethylphenyl)benzamide (PubChem CID 58342801) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[(2R,3S)-7-[carbamothioyl(hydroxy)amino]-2-hydroxy-4-oxoheptan-3-yl]-4-(4-ethylphenyl)benzamide.
| Compound Name | N-[(2R,3S)-7-[carbamothioyl(hydroxy)amino]-2-hydroxy-4-oxoheptan-3-yl]-4-(4-ethylphenyl)benzamide |
|---|---|
| PubChem CID | 58342801 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[(2R,3S)-7-[carbamothioyl(hydroxy)amino]-2-hydroxy-4-oxoheptan-3-yl]-4-(4-ethylphenyl)benzamide |
| SMILES | CCc1ccc(-c2ccc(C(=O)N[C@H](C(=O)CCCN(O)C(N)=S)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-3-16-6-8-17(9-7-16)18-10-12-19(13-11-18)22(29)25-21(15(2)27)20(28)5-4-14-26(30)23(24)31/h6-13,15,21,27,30H,3-5,14H2,1-2H3,(H2,24,31)(H,25,29)/t15-,21+/m1/s1 |
| InChIKey | ITZYIYYOEDOPKT-VFNWGFHPSA-N |
| XLogP | 2.68 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|