C26H35N5O5 — CID 159620953
N-[(2S,3R)-1-[2-[2-cyanoethylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide;methane (PubChem CID 159620953) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(2S,3R)-1-[2-[2-cyanoethylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide;methane.
| Compound Name | N-[(2S,3R)-1-[2-[2-cyanoethylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide;methane |
|---|---|
| PubChem CID | 159620953 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | N-[(2S,3R)-1-[2-[2-cyanoethylcarbamoyl(hydroxy)amino]ethylamino]-3-hydroxy-1-oxobutan-2-yl]-4-(4-ethylphenyl)benzamide;methane |
| SMILES | C.CCc1ccc(-c2ccc(C(=O)N[C@H](C(=O)NCCN(O)C(=O)NCCC#N)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C25H31N5O5.CH4/c1-3-18-5-7-19(8-6-18)20-9-11-21(12-10-20)23(32)29-22(17(2)31)24(33)27-15-16-30(35)25(34)28-14-4-13-26;/h5-12,17,22,31,35H,3-4,14-16H2,1-2H3,(H,27,33)(H,28,34)(H,29,32);1H4/t17-,22+;/m1./s1 |
| InChIKey | MNWNDWYBCGPVHT-YITVUBHWSA-N |
| XLogP | 2.46 |
| TPSA | 154.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|