C27H32N6O5 — CID 87111069
[1-cyano-5-[2-cyanoethylcarbamoyl(hydroxy)amino]-1-[[4-(4-ethylphenyl)benzoyl]amino]-3-methylpentan-2-yl] carbamate (PubChem CID 87111069) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is [1-cyano-5-[2-cyanoethylcarbamoyl(hydroxy)amino]-1-[[4-(4-ethylphenyl)benzoyl]amino]-3-methylpentan-2-yl] carbamate.
| Compound Name | [1-cyano-5-[2-cyanoethylcarbamoyl(hydroxy)amino]-1-[[4-(4-ethylphenyl)benzoyl]amino]-3-methylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 87111069 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [1-cyano-5-[2-cyanoethylcarbamoyl(hydroxy)amino]-1-[[4-(4-ethylphenyl)benzoyl]amino]-3-methylpentan-2-yl] carbamate |
| SMILES | CCc1ccc(-c2ccc(C(=O)NC(C#N)C(OC(N)=O)C(C)CCN(O)C(=O)NCCC#N)cc2)cc1 |
| InChI | InChI=1S/C27H32N6O5/c1-3-19-5-7-20(8-6-19)21-9-11-22(12-10-21)25(34)32-23(17-29)24(38-26(30)35)18(2)13-16-33(37)27(36)31-15-4-14-28/h5-12,18,23-24,37H,3-4,13,15-16H2,1-2H3,(H2,30,35)(H,31,36)(H,32,34) |
| InChIKey | LHYBCEMYWBTMAW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 181.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|