C25H34N4O6 — CID 59697916
4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-[hydroxy(2-methoxyethylcarbamoyl)amino]ethylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 59697916) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-[hydroxy(2-methoxyethylcarbamoyl)amino]ethylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-[hydroxy(2-methoxyethylcarbamoyl)amino]ethylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697916 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-[hydroxy(2-methoxyethylcarbamoyl)amino]ethylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | CCc1ccc(-c2ccc(C(=O)N[C@H](C(=O)NCCN(O)C(=O)NCCOC)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C25H34N4O6/c1-4-18-5-7-19(8-6-18)20-9-11-21(12-10-20)23(31)28-22(17(2)30)24(32)26-13-15-29(34)25(33)27-14-16-35-3/h5-12,17,22,30,34H,4,13-16H2,1-3H3,(H,26,32)(H,27,33)(H,28,31)/t17-,22+/m1/s1 |
| InChIKey | OVWVENTUCRFBMG-VGSWGCGISA-N |
| XLogP | 1.56 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|