C25H34N3O4+ — CID 88546881
4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-(1-hydroxypyrrolidin-1-ium-1-yl)ethylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 88546881) has the molecular formula C25H34N3O4+ and a molecular weight of 440.56 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-(1-hydroxypyrrolidin-1-ium-1-yl)ethylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-(1-hydroxypyrrolidin-1-ium-1-yl)ethylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 88546881 |
| Molecular Formula | C25H34N3O4+ |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 4-(4-ethylphenyl)-N-[(2S,3R)-3-hydroxy-1-[2-(1-hydroxypyrrolidin-1-ium-1-yl)ethylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | CCc1ccc(-c2ccc(C(=O)N[C@H](C(=O)NCC[N+]3(O)CCCC3)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-3-19-6-8-20(9-7-19)21-10-12-22(13-11-21)24(30)27-23(18(2)29)25(31)26-14-17-28(32)15-4-5-16-28/h6-13,18,23,29,32H,3-5,14-17H2,1-2H3,(H-,26,27,30,31)/p+1/t18-,23+/m1/s1 |
| InChIKey | OSRJXLOBRBYYFD-JPYJTQIMSA-O |
| XLogP | 2.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|