C48H59N5O8 — CID 59711631
(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-[2-nitro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)phenoxy]oxane-3,4,5-triol (PubChem CID 59711631) has the molecular formula C48H59N5O8 and a molecular weight of 834.03 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-[2-nitro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-[2-nitro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59711631 |
| Molecular Formula | C48H59N5O8 |
| Molecular Weight | 834.03 g/mol |
| Exact Mass | 833.44 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-[2-nitro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)phenoxy]oxane-3,4,5-triol |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2-c2ccc(O[C@@H]5O[C@H](CO)[C@H](O)[C@H](O)[C@@H]5O)c([N+](=O)[O-])c2)C(CC)=C4CC)c(CC)c3CC)c(CC)c1CC |
| InChI | InChI=1S/C48H59N5O8/c1-9-25-27(11-3)35-21-37-29(13-5)31(15-7)43(51-37)42(24-17-18-40(39(19-24)53(58)59)60-48-47(57)46(56)45(55)41(23-54)61-48)44-32(16-8)30(14-6)38(52-44)22-36-28(12-4)26(10-2)34(50-36)20-33(25)49-35/h17-22,41,45-50,54-57H,9-16,23H2,1-8H3/b33-20-,34-20-,35-21-,36-22-,37-21-,38-22-,43-42-,44-42-/t41-,45+,46+,47+,48-/m1/s1 |
| InChIKey | CULSXFVAIOVLTM-PIEUGJPRSA-N |
| XLogP | 8.78 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.03 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|