C33H42O5 — CID 59728429
6-[4-[4-[(6-methyl-2-oxo-3-propan-2-ylcyclohexyl)methyl]benzoyl]phenoxy]hexyl prop-2-enoate (PubChem CID 59728429) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is 6-[4-[4-[(6-methyl-2-oxo-3-propan-2-ylcyclohexyl)methyl]benzoyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[4-[(6-methyl-2-oxo-3-propan-2-ylcyclohexyl)methyl]benzoyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 59728429 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 6-[4-[4-[(6-methyl-2-oxo-3-propan-2-ylcyclohexyl)methyl]benzoyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)c2ccc(CC3C(=O)C(C(C)C)CCC3C)cc2)cc1 |
| InChI | InChI=1S/C33H42O5/c1-5-31(34)38-21-9-7-6-8-20-37-28-17-15-27(16-18-28)32(35)26-13-11-25(12-14-26)22-30-24(4)10-19-29(23(2)3)33(30)36/h5,11-18,23-24,29-30H,1,6-10,19-22H2,2-4H3 |
| InChIKey | BPBNXXYBLASPAH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|