C31H38O9 — CID 59749829
(1S,3R,5Z,7S,14R,16S,19R,21R,22R,23S,29S,31R)-22-phenylmethoxy-2,8,10,12,15,20,24,30-octaoxahexacyclo[17.13.0.03,16.07,14.021,31.023,29]dotriaconta-5,17,26-triene (PubChem CID 59749829) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is (1S,3R,5Z,7S,14R,16S,19R,21R,22R,23S,29S,31R)-22-phenylmethoxy-2,8,10,12,15,20,24,30-octaoxahexacyclo[17.13.0.03,16.07,14.021,31.023,29]dotriaconta-5,17,26-triene.
| Compound Name | (1S,3R,5Z,7S,14R,16S,19R,21R,22R,23S,29S,31R)-22-phenylmethoxy-2,8,10,12,15,20,24,30-octaoxahexacyclo[17.13.0.03,16.07,14.021,31.023,29]dotriaconta-5,17,26-triene |
|---|---|
| PubChem CID | 59749829 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | (1S,3R,5Z,7S,14R,16S,19R,21R,22R,23S,29S,31R)-22-phenylmethoxy-2,8,10,12,15,20,24,30-octaoxahexacyclo[17.13.0.03,16.07,14.021,31.023,29]dotriaconta-5,17,26-triene |
| SMILES | C1=CC[C@@H]2O[C@@H]3C[C@@H]4O[C@@H]5C/C=C\[C@@H]6OCOCOC[C@H]6O[C@H]5C=C[C@H]4O[C@H]3[C@H](OCc3ccccc3)[C@H]2OC1 |
| InChI | InChI=1S/C31H38O9/c1-2-7-20(8-3-1)16-35-31-29-25(9-4-5-14-34-29)39-27-15-26-24(40-30(27)31)13-12-23-22(37-26)11-6-10-21-28(38-23)17-32-18-33-19-36-21/h1-8,10,12-13,21-31H,9,11,14-19H2/b10-6-/t21-,22+,23-,24+,25-,26-,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | OBVYISGQWONPTC-VIICJZGGSA-N |
| XLogP | 3.23 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|