C15H8F3NO2 — CID 59760365
(2-fluoro-4-methylphenyl) 4-cyano-3,5-difluorobenzoate (PubChem CID 59760365) has the molecular formula C15H8F3NO2 and a molecular weight of 291.23 g/mol. Its IUPAC name is (2-fluoro-4-methylphenyl) 4-cyano-3,5-difluorobenzoate.
| Compound Name | (2-fluoro-4-methylphenyl) 4-cyano-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 59760365 |
| Molecular Formula | C15H8F3NO2 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (2-fluoro-4-methylphenyl) 4-cyano-3,5-difluorobenzoate |
| SMILES | Cc1ccc(OC(=O)c2cc(F)c(C#N)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H8F3NO2/c1-8-2-3-14(13(18)4-8)21-15(20)9-5-11(16)10(7-19)12(17)6-9/h2-6H,1H3 |
| InChIKey | URQYGSPZLPOSKD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|