About 3H-pyridin-3-ide-6-carboxylic acid;yttrium
3H-pyridin-3-ide-6-carboxylic acid;yttrium (PubChem CID 59774757) has the molecular formula C6H4NO2Y-
and a molecular weight of 211.01 g/mol. Its IUPAC name is 3H-pyridin-3-ide-6-carboxylic acid;yttrium.
Molecular Properties
| Compound Name | 3H-pyridin-3-ide-6-carboxylic acid;yttrium |
| PubChem CID | 59774757 |
| Molecular Formula | C6H4NO2Y- |
| Molecular Weight | 211.01 g/mol |
| Exact Mass | 210.93 |
| IUPAC Name | 3H-pyridin-3-ide-6-carboxylic acid;yttrium |
| SMILES | O=C(O)c1cc[c-]cn1.[Y] |
| InChI | InChI=1S/C6H4NO2.Y/c8-6(9)5-3-1-2-4-7-5;/h1,3-4H,(H,8,9);/q-1; |
| InChIKey | GPMGBNHXUXIFMH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.01 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3H-pyridin-3-ide-6-carboxylic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-pyridin-3-ide-6-carboxylic acid;yttrium?
The IUPAC name of 3H-pyridin-3-ide-6-carboxylic acid;yttrium (CID 59774757) is 3H-pyridin-3-ide-6-carboxylic acid;yttrium.
What is the SMILES notation for 3H-pyridin-3-ide-6-carboxylic acid;yttrium?
The canonical SMILES for 3H-pyridin-3-ide-6-carboxylic acid;yttrium is O=C(O)c1cc[c-]cn1.[Y].
What is the InChIKey of 3H-pyridin-3-ide-6-carboxylic acid;yttrium?
The InChIKey is GPMGBNHXUXIFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4NO2.Y/c8-6(9)5-3-1-2-4-7-5;/h1,3-4H,(H,8,9);/q-1;.
What are the key properties of 3H-pyridin-3-ide-6-carboxylic acid;yttrium?
3H-pyridin-3-ide-6-carboxylic acid;yttrium has a molecular weight of 211.01 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-pyridin-3-ide-6-carboxylic acid;yttrium is sourced from PubChem (CID 59774757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).