C20H22BrFMgN2O2 — CID 59780105
magnesium;4-(dimethylamino)-1-(4-fluorophenyl)-1-[2-(hydroxymethyl)-4-isocyanophenyl]butan-1-olate;bromide (PubChem CID 59780105) has the molecular formula C20H22BrFMgN2O2 and a molecular weight of 445.62 g/mol. Its IUPAC name is magnesium;4-(dimethylamino)-1-(4-fluorophenyl)-1-[2-(hydroxymethyl)-4-isocyanophenyl]butan-1-olate;bromide.
| Compound Name | magnesium;4-(dimethylamino)-1-(4-fluorophenyl)-1-[2-(hydroxymethyl)-4-isocyanophenyl]butan-1-olate;bromide |
|---|---|
| PubChem CID | 59780105 |
| Molecular Formula | C20H22BrFMgN2O2 |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | magnesium;4-(dimethylamino)-1-(4-fluorophenyl)-1-[2-(hydroxymethyl)-4-isocyanophenyl]butan-1-olate;bromide |
| SMILES | [Br-].[C-]#[N+]c1ccc(C([O-])(CCCN(C)C)c2ccc(F)cc2)c(CO)c1.[Mg+2] |
| InChI | InChI=1S/C20H22FN2O2.BrH.Mg/c1-22-18-9-10-19(15(13-18)14-24)20(25,11-4-12-23(2)3)16-5-7-17(21)8-6-16;;/h5-10,13,24H,4,11-12,14H2,2-3H3;1H;/q-1;;+2/p-1 |
| InChIKey | YKPGDHULZYRPOL-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|