C25H26ClN3O5S — CID 59788778
N-[4-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide (PubChem CID 59788778) has the molecular formula C25H26ClN3O5S and a molecular weight of 516.02 g/mol. Its IUPAC name is N-[4-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide.
| Compound Name | N-[4-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 59788778 |
| Molecular Formula | C25H26ClN3O5S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | N-[4-chloro-2-(6-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)c2cc(Cl)ccc2NS(=O)(=O)c2ccc(N3C[C@@H](C)O[C@@H](C)C3)cc2)c[n+]1[O-] |
| InChI | InChI=1S/C25H26ClN3O5S/c1-16-4-5-19(15-29(16)31)25(30)23-12-20(26)6-11-24(23)27-35(32,33)22-9-7-21(8-10-22)28-13-17(2)34-18(3)14-28/h4-12,15,17-18,27H,13-14H2,1-3H3/t17-,18+ |
| InChIKey | VFMJIJSFZSUUSI-HDICACEKSA-N |
| XLogP | 3.93 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|