About 4-hydroxybutan-2-one;vanadium
4-hydroxybutan-2-one;vanadium (PubChem CID 59796959) has the molecular formula C4H7O2V-
and a molecular weight of 138.04 g/mol. Its IUPAC name is 4-hydroxybutan-2-one;vanadium.
Molecular Properties
| Compound Name | 4-hydroxybutan-2-one;vanadium |
| PubChem CID | 59796959 |
| Molecular Formula | C4H7O2V- |
| Molecular Weight | 138.04 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | 4-hydroxybutan-2-one;vanadium |
| SMILES | CC(=O)C[CH-]O.[V] |
| InChI | InChI=1S/C4H7O2.V/c1-4(6)2-3-5;/h3,5H,2H2,1H3;/q-1; |
| InChIKey | XCXDBNPDZNITJL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.04 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutan-2-one;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutan-2-one;vanadium?
The IUPAC name of 4-hydroxybutan-2-one;vanadium (CID 59796959) is 4-hydroxybutan-2-one;vanadium.
What is the SMILES notation for 4-hydroxybutan-2-one;vanadium?
The canonical SMILES for 4-hydroxybutan-2-one;vanadium is CC(=O)C[CH-]O.[V].
What is the InChIKey of 4-hydroxybutan-2-one;vanadium?
The InChIKey is XCXDBNPDZNITJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O2.V/c1-4(6)2-3-5;/h3,5H,2H2,1H3;/q-1;.
What are the key properties of 4-hydroxybutan-2-one;vanadium?
4-hydroxybutan-2-one;vanadium has a molecular weight of 138.04 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutan-2-one;vanadium is sourced from PubChem (CID 59796959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).