C31H35F9O6 — CID 59812430
3-[(2-methylpropan-2-yl)oxycarbonyl]-5-naphthalen-2-yl-2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1-oxopropan-2-yl]heptanoic acid (PubChem CID 59812430) has the molecular formula C31H35F9O6 and a molecular weight of 674.60 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonyl]-5-naphthalen-2-yl-2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1-oxopropan-2-yl]heptanoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-5-naphthalen-2-yl-2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1-oxopropan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 59812430 |
| Molecular Formula | C31H35F9O6 |
| Molecular Weight | 674.60 g/mol |
| Exact Mass | 674.23 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-5-naphthalen-2-yl-2-[1-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1-oxopropan-2-yl]heptanoic acid |
| SMILES | CCC(CC(C(=O)OC(C)(C)C)C(C(=O)O)C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H35F9O6/c1-6-18(21-12-11-19-9-7-8-10-20(19)15-21)16-22(26(44)46-27(3,4)5)23(24(41)42)17(2)25(43)45-14-13-28(32,33)29(34,35)30(36,37)31(38,39)40/h7-12,15,17-18,22-23H,6,13-14,16H2,1-5H3,(H,41,42) |
| InChIKey | GKUUQQFQHNDYBE-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.60 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|