C21H23F2O6S- — CID 59839330
[3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-methylbenzoate (PubChem CID 59839330) has the molecular formula C21H23F2O6S- and a molecular weight of 441.47 g/mol. Its IUPAC name is [3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-methylbenzoate.
| Compound Name | [3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 59839330 |
| Molecular Formula | C21H23F2O6S- |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [3-[(2,2-difluoro-2-oxidooxysulfanylacetyl)oxymethyl]-1-adamantyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC23CC4CC(CC(COC(=O)C(F)(F)SO[O-])(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H24F2O6S/c1-13-2-4-16(5-3-13)17(24)28-20-9-14-6-15(10-20)8-19(7-14,11-20)12-27-18(25)21(22,23)30-29-26/h2-5,14-15,26H,6-12H2,1H3/p-1 |
| InChIKey | DODDUIFHEIXJDD-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|