C16H20N2O2S — CID 59858231
2-(2,6-ditert-butyl-1,1-dioxothiopyran-4-ylidene)-2-isocyanoacetonitrile (PubChem CID 59858231) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-(2,6-ditert-butyl-1,1-dioxothiopyran-4-ylidene)-2-isocyanoacetonitrile.
| Compound Name | 2-(2,6-ditert-butyl-1,1-dioxothiopyran-4-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59858231 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(2,6-ditert-butyl-1,1-dioxothiopyran-4-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(C(C)(C)C)S(=O)(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C16H20N2O2S/c1-15(2,3)13-8-11(12(10-17)18-7)9-14(16(4,5)6)21(13,19)20/h8-9H,1-6H3 |
| InChIKey | YGBVZYWGAUTMRH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|