C18H16N2O2S — CID 72579713
2-(2-butyl-1,1-dioxo-6-phenylthiopyran-4-ylidene)-2-isocyanoacetonitrile (PubChem CID 72579713) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-(2-butyl-1,1-dioxo-6-phenylthiopyran-4-ylidene)-2-isocyanoacetonitrile.
| Compound Name | 2-(2-butyl-1,1-dioxo-6-phenylthiopyran-4-ylidene)-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 72579713 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-(2-butyl-1,1-dioxo-6-phenylthiopyran-4-ylidene)-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1C=C(CCCC)S(=O)(=O)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C18H16N2O2S/c1-3-4-10-16-11-15(17(13-19)20-2)12-18(23(16,21)22)14-8-6-5-7-9-14/h5-9,11-12H,3-4,10H2,1H3 |
| InChIKey | FFRQKTLJMRNLJS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|