C10H8ClN3O2S — CID 59864679
ethyl 2-chloro-4-pyrimidin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 59864679) has the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. Its IUPAC name is ethyl 2-chloro-4-pyrimidin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-chloro-4-pyrimidin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59864679 |
| Molecular Formula | C10H8ClN3O2S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | ethyl 2-chloro-4-pyrimidin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Cl)nc1-c1ncccn1 |
| InChI | InChI=1S/C10H8ClN3O2S/c1-2-16-9(15)7-6(14-10(11)17-7)8-12-4-3-5-13-8/h3-5H,2H2,1H3 |
| InChIKey | OPVAQIZAVJYLOQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |