C18H32N2O7 — CID 59871972
methyl 2-[3-(1,2-dimethoxy-2-oxoethyl)-4,4,5,5,6,6-hexamethyl-2-oxo-1,3-diazinan-1-yl]-2-methoxyacetate (PubChem CID 59871972) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl 2-[3-(1,2-dimethoxy-2-oxoethyl)-4,4,5,5,6,6-hexamethyl-2-oxo-1,3-diazinan-1-yl]-2-methoxyacetate.
| Compound Name | methyl 2-[3-(1,2-dimethoxy-2-oxoethyl)-4,4,5,5,6,6-hexamethyl-2-oxo-1,3-diazinan-1-yl]-2-methoxyacetate |
|---|---|
| PubChem CID | 59871972 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl 2-[3-(1,2-dimethoxy-2-oxoethyl)-4,4,5,5,6,6-hexamethyl-2-oxo-1,3-diazinan-1-yl]-2-methoxyacetate |
| SMILES | COC(=O)C(OC)N1C(=O)N(C(OC)C(=O)OC)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H32N2O7/c1-16(2)17(3,4)19(11(24-7)13(21)26-9)15(23)20(18(16,5)6)12(25-8)14(22)27-10/h11-12H,1-10H3 |
| InChIKey | LQNOLVYRGGISSX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |