C20H18N2O4S — CID 53315383
methyl 2-[5-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-3-oxo-1,2-thiazol-2-yl]-3-phenylpropanoate (PubChem CID 53315383) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-3-oxo-1,2-thiazol-2-yl]-3-phenylpropanoate.
| Compound Name | methyl 2-[5-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-3-oxo-1,2-thiazol-2-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 53315383 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | methyl 2-[5-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]-3-oxo-1,2-thiazol-2-yl]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)n1sc(/C(=N\O)c2ccccc2)cc1=O |
| InChI | InChI=1S/C20H18N2O4S/c1-26-20(24)16(12-14-8-4-2-5-9-14)22-18(23)13-17(27-22)19(21-25)15-10-6-3-7-11-15/h2-11,13,16,25H,12H2,1H3/b21-19- |
| InChIKey | OJTMFYAHSPLTET-VZCXRCSSSA-N |
| XLogP | 3.09 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|