C9H14F6O8S3 — CID 59872382
bis(trifluoromethyl) hexylsulfonylmethanedisulfonate (PubChem CID 59872382) has the molecular formula C9H14F6O8S3 and a molecular weight of 460.39 g/mol. Its IUPAC name is bis(trifluoromethyl) hexylsulfonylmethanedisulfonate.
| Compound Name | bis(trifluoromethyl) hexylsulfonylmethanedisulfonate |
|---|---|
| PubChem CID | 59872382 |
| Molecular Formula | C9H14F6O8S3 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.98 |
| IUPAC Name | bis(trifluoromethyl) hexylsulfonylmethanedisulfonate |
| SMILES | CCCCCCS(=O)(=O)C(S(=O)(=O)OC(F)(F)F)S(=O)(=O)OC(F)(F)F |
| InChI | InChI=1S/C9H14F6O8S3/c1-2-3-4-5-6-24(16,17)7(25(18,19)22-8(10,11)12)26(20,21)23-9(13,14)15/h7H,2-6H2,1H3 |
| InChIKey | SZXVYKNNJGTSBA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|