C8H11F4O6S3- — CID 59584386
1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclopentane (PubChem CID 59584386) has the molecular formula C8H11F4O6S3- and a molecular weight of 375.36 g/mol. Its IUPAC name is 1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclopentane.
| Compound Name | 1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclopentane |
|---|---|
| PubChem CID | 59584386 |
| Molecular Formula | C8H11F4O6S3- |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 1-fluoro-3-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclopentane |
| SMILES | CS(=O)(=O)[C-](S(=O)(=O)C1CCC(F)C1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F4O6S3/c1-19(13,14)7(21(17,18)8(10,11)12)20(15,16)6-3-2-5(9)4-6/h5-6H,2-4H2,1H3/q-1 |
| InChIKey | RZOWMTKPAKJNAX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|