C9H7F10O4S2- — CID 59584282
1,2,3,4-tetrafluoro-5-[3,3,3-trifluoro-1-(trifluoromethylsulfonyl)propyl]sulfonylcyclopentane (PubChem CID 59584282) has the molecular formula C9H7F10O4S2- and a molecular weight of 433.27 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-[3,3,3-trifluoro-1-(trifluoromethylsulfonyl)propyl]sulfonylcyclopentane.
| Compound Name | 1,2,3,4-tetrafluoro-5-[3,3,3-trifluoro-1-(trifluoromethylsulfonyl)propyl]sulfonylcyclopentane |
|---|---|
| PubChem CID | 59584282 |
| Molecular Formula | C9H7F10O4S2- |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-[3,3,3-trifluoro-1-(trifluoromethylsulfonyl)propyl]sulfonylcyclopentane |
| SMILES | O=S(=O)([C-](CC(F)(F)F)S(=O)(=O)C(F)(F)F)C1C(F)C(F)C(F)C1F |
| InChI | InChI=1S/C9H7F10O4S2/c10-3-4(11)6(13)7(5(3)12)24(20,21)2(1-8(14,15)16)25(22,23)9(17,18)19/h3-7H,1H2/q-1 |
| InChIKey | WKDOHNHWCGUUKO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|