C8H8F7O6S3- — CID 59584388
1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluorocyclopentane (PubChem CID 59584388) has the molecular formula C8H8F7O6S3- and a molecular weight of 429.33 g/mol. Its IUPAC name is 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluorocyclopentane.
| Compound Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluorocyclopentane |
|---|---|
| PubChem CID | 59584388 |
| Molecular Formula | C8H8F7O6S3- |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 428.94 |
| IUPAC Name | 1-[bis(trifluoromethylsulfonyl)methylsulfonyl]-3-fluorocyclopentane |
| SMILES | O=S(=O)([C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C1CCC(F)C1 |
| InChI | InChI=1S/C8H8F7O6S3/c9-4-1-2-5(3-4)22(16,17)6(23(18,19)7(10,11)12)24(20,21)8(13,14)15/h4-5H,1-3H2/q-1 |
| InChIKey | YFUREBSEZSIICS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|