C23H40N4O6S — CID 59873644
methyl (2S)-2-[methyl(methylsulfonyl)amino]-3-[4-[2,4,4-trimethyl-5-[(N'-methylcarbamimidoyl)amino]oxyhexoxy]phenyl]propanoate (PubChem CID 59873644) has the molecular formula C23H40N4O6S and a molecular weight of 500.66 g/mol. Its IUPAC name is methyl (2S)-2-[methyl(methylsulfonyl)amino]-3-[4-[2,4,4-trimethyl-5-[(N'-methylcarbamimidoyl)amino]oxyhexoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[methyl(methylsulfonyl)amino]-3-[4-[2,4,4-trimethyl-5-[(N'-methylcarbamimidoyl)amino]oxyhexoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 59873644 |
| Molecular Formula | C23H40N4O6S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | methyl (2S)-2-[methyl(methylsulfonyl)amino]-3-[4-[2,4,4-trimethyl-5-[(N'-methylcarbamimidoyl)amino]oxyhexoxy]phenyl]propanoate |
| SMILES | C/N=C(\N)NOC(C)C(C)(C)CC(C)COc1ccc(C[C@@H](C(=O)OC)N(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H40N4O6S/c1-16(14-23(3,4)17(2)33-26-22(24)25-5)15-32-19-11-9-18(10-12-19)13-20(21(28)31-7)27(6)34(8,29)30/h9-12,16-17,20H,13-15H2,1-8H3,(H3,24,25,26)/t16?,17?,20-/m0/s1 |
| InChIKey | GALXPEBPBMNWBW-UHYCVJNDSA-N |
| XLogP | 1.95 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|