C24H28FN3O2 — CID 59883068
N'-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]ethanimidamide (PubChem CID 59883068) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is N'-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]ethanimidamide.
| Compound Name | N'-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]ethanimidamide |
|---|---|
| PubChem CID | 59883068 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N'-[(Z)-4-fluoro-5-(4-methyl-2-oxo-5,6-diphenylmorpholin-3-yl)pent-3-enyl]ethanimidamide |
| SMILES | C/C(N)=N\CC/C=C(\F)CC1C(=O)OC(c2ccccc2)C(c2ccccc2)N1C |
| InChI | InChI=1S/C24H28FN3O2/c1-17(26)27-15-9-14-20(25)16-21-24(29)30-23(19-12-7-4-8-13-19)22(28(21)2)18-10-5-3-6-11-18/h3-8,10-14,21-23H,9,15-16H2,1-2H3,(H2,26,27)/b20-14- |
| InChIKey | XMQNPZXXWFGVMH-ZHZULCJRSA-N |
| XLogP | 4.34 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|