C16H16N2O2 — CID 59887435
3-isocyano-3-[isocyano(phenyl)methyl]heptane-2,6-dione (PubChem CID 59887435) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-isocyano-3-[isocyano(phenyl)methyl]heptane-2,6-dione.
| Compound Name | 3-isocyano-3-[isocyano(phenyl)methyl]heptane-2,6-dione |
|---|---|
| PubChem CID | 59887435 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-isocyano-3-[isocyano(phenyl)methyl]heptane-2,6-dione |
| SMILES | [C-]#[N+]C(c1ccccc1)C(CCC(C)=O)([N+]#[C-])C(C)=O |
| InChI | InChI=1S/C16H16N2O2/c1-12(19)10-11-16(18-4,13(2)20)15(17-3)14-8-6-5-7-9-14/h5-9,15H,10-11H2,1-2H3 |
| InChIKey | ODNSVMVBQZJSCR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|