About (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+)
(3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) (PubChem CID 59894892) has the molecular formula C10H14NOPrRb
and a molecular weight of 390.60 g/mol. Its IUPAC name is (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+).
Molecular Properties
| Compound Name | (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) |
| PubChem CID | 59894892 |
| Molecular Formula | C10H14NOPrRb |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) |
| SMILES | CC(O)C([NH-])Cc1ccccc1.[Pr].[Rb+] |
| InChI | InChI=1S/C10H14NO.Pr.Rb/c1-8(12)10(11)7-9-5-3-2-4-6-9;;/h2-6,8,10-12H,7H2,1H3;;/q-1;;+1 |
| InChIKey | YIPXACXFGGWSRO-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 44.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+)?
The IUPAC name of (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) (CID 59894892) is (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+).
What is the SMILES notation for (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+)?
The canonical SMILES for (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) is CC(O)C([NH-])Cc1ccccc1.[Pr].[Rb+].
What is the InChIKey of (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+)?
The InChIKey is YIPXACXFGGWSRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO.Pr.Rb/c1-8(12)10(11)7-9-5-3-2-4-6-9;;/h2-6,8,10-12H,7H2,1H3;;/q-1;;+1.
What are the key properties of (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+)?
(3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) has a molecular weight of 390.60 g/mol, XLogP of -0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-phenylbutan-2-yl)azanide;praseodymium;rubidium(1+) is sourced from PubChem (CID 59894892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).