C44H35ClS2+2 — CID 59896801
2-[(Z)-2-[(3E)-2-chloro-3-[(2E)-2-(4,6-diphenylthiopyran-1-ium-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-4,6-diphenylthiopyrylium (PubChem CID 59896801) has the molecular formula C44H35ClS2+2 and a molecular weight of 663.35 g/mol. Its IUPAC name is 2-[(Z)-2-[(3E)-2-chloro-3-[(2E)-2-(4,6-diphenylthiopyran-1-ium-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-4,6-diphenylthiopyrylium.
| Compound Name | 2-[(Z)-2-[(3E)-2-chloro-3-[(2E)-2-(4,6-diphenylthiopyran-1-ium-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-4,6-diphenylthiopyrylium |
|---|---|
| PubChem CID | 59896801 |
| Molecular Formula | C44H35ClS2+2 |
| Molecular Weight | 663.35 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | 2-[(Z)-2-[(3E)-2-chloro-3-[(2E)-2-(4,6-diphenylthiopyran-1-ium-2-ylidene)ethylidene]cyclohexen-1-yl]ethenyl]-4,6-diphenylthiopyrylium |
| SMILES | ClC1=C(/C=C\c2cc(-c3ccccc3)cc(-c3ccccc3)[s+]2)CCC/C1=C\C=C1/C=C(c2ccccc2)C=C(c2ccccc2)[SH+]1 |
| InChI | InChI=1S/C44H34ClS2/c45-44-36(24-26-40-28-38(32-14-5-1-6-15-32)30-42(46-40)34-18-9-3-10-19-34)22-13-23-37(44)25-27-41-29-39(33-16-7-2-8-17-33)31-43(47-41)35-20-11-4-12-21-35/h1-12,14-21,24-31H,13,22-23H2/q+1/p+1 |
| InChIKey | QTEMACMQGFYOFP-UHFFFAOYSA-O |
| XLogP | 12.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.35 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|