C24H14Cl2FN3O5S2 — CID 59908282
(3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(4-fluorophenyl)-2-oxoindole-5-sulfonamide (PubChem CID 59908282) has the molecular formula C24H14Cl2FN3O5S2 and a molecular weight of 578.43 g/mol. Its IUPAC name is (3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(4-fluorophenyl)-2-oxoindole-5-sulfonamide.
| Compound Name | (3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(4-fluorophenyl)-2-oxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 59908282 |
| Molecular Formula | C24H14Cl2FN3O5S2 |
| Molecular Weight | 578.43 g/mol |
| Exact Mass | 576.97 |
| IUPAC Name | (3Z)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(4-fluorophenyl)-2-oxoindole-5-sulfonamide |
| SMILES | O=C1NC(=O)/C(=C2/C(=O)N(Cc3ccc(Cl)c(Cl)c3)c3ccc(S(=O)(=O)Nc4ccc(F)cc4)cc32)S1 |
| InChI | InChI=1S/C24H14Cl2FN3O5S2/c25-17-7-1-12(9-18(17)26)11-30-19-8-6-15(37(34,35)29-14-4-2-13(27)3-5-14)10-16(19)20(23(30)32)21-22(31)28-24(33)36-21/h1-10,29H,11H2,(H,28,31,33)/b21-20- |
| InChIKey | ZONBJVFXWIBDFQ-MRCUWXFGSA-N |
| XLogP | 5.17 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|