C24H15Cl2N3O6S2 — CID 18721869
(3E)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-hydroxyphenyl)-2-oxoindole-5-sulfonamide (PubChem CID 18721869) has the molecular formula C24H15Cl2N3O6S2 and a molecular weight of 576.44 g/mol. Its IUPAC name is (3E)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-hydroxyphenyl)-2-oxoindole-5-sulfonamide.
| Compound Name | (3E)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-hydroxyphenyl)-2-oxoindole-5-sulfonamide |
|---|---|
| PubChem CID | 18721869 |
| Molecular Formula | C24H15Cl2N3O6S2 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 574.98 |
| IUPAC Name | (3E)-1-[(3,4-dichlorophenyl)methyl]-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-N-(2-hydroxyphenyl)-2-oxoindole-5-sulfonamide |
| SMILES | O=C1NC(=O)/C(=C2\C(=O)N(Cc3ccc(Cl)c(Cl)c3)c3ccc(S(=O)(=O)Nc4ccccc4O)cc32)S1 |
| InChI | InChI=1S/C24H15Cl2N3O6S2/c25-15-7-5-12(9-16(15)26)11-29-18-8-6-13(37(34,35)28-17-3-1-2-4-19(17)30)10-14(18)20(23(29)32)21-22(31)27-24(33)36-21/h1-10,28,30H,11H2,(H,27,31,33)/b21-20+ |
| InChIKey | FQGKKIMCOAYIEV-QZQOTICOSA-N |
| XLogP | 4.74 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|