C22H30O2Si — CID 59912172
2-[1-phenyl-3-(2-trimethylsilyloxyethyl)-2,3-dihydro-1H-inden-2-yl]ethanol (PubChem CID 59912172) has the molecular formula C22H30O2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is 2-[1-phenyl-3-(2-trimethylsilyloxyethyl)-2,3-dihydro-1H-inden-2-yl]ethanol.
| Compound Name | 2-[1-phenyl-3-(2-trimethylsilyloxyethyl)-2,3-dihydro-1H-inden-2-yl]ethanol |
|---|---|
| PubChem CID | 59912172 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-[1-phenyl-3-(2-trimethylsilyloxyethyl)-2,3-dihydro-1H-inden-2-yl]ethanol |
| SMILES | C[Si](C)(C)OCCC1c2ccccc2C(c2ccccc2)C1CCO |
| InChI | InChI=1S/C22H30O2Si/c1-25(2,3)24-16-14-19-18-11-7-8-12-20(18)22(21(19)13-15-23)17-9-5-4-6-10-17/h4-12,19,21-23H,13-16H2,1-3H3 |
| InChIKey | NPEWZTMVLYBHAG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|