C22H33N3O — CID 59913456
N-cyano-N'-[(2,2-dimethylcyclopentyl)methyl]-4-hexoxybenzenecarboximidamide (PubChem CID 59913456) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is N-cyano-N'-[(2,2-dimethylcyclopentyl)methyl]-4-hexoxybenzenecarboximidamide.
| Compound Name | N-cyano-N'-[(2,2-dimethylcyclopentyl)methyl]-4-hexoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 59913456 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | N-cyano-N'-[(2,2-dimethylcyclopentyl)methyl]-4-hexoxybenzenecarboximidamide |
| SMILES | CCCCCCOc1ccc(/C(=N/CC2CCCC2(C)C)NC#N)cc1 |
| InChI | InChI=1S/C22H33N3O/c1-4-5-6-7-15-26-20-12-10-18(11-13-20)21(25-17-23)24-16-19-9-8-14-22(19,2)3/h10-13,19H,4-9,14-16H2,1-3H3,(H,24,25) |
| InChIKey | PNDHFXVMYLTUCF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|