C33H53N3O9 — CID 59918345
4-[2-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxymethyl]-2-[(4-methylcyclohexyl)carbamoyloxymethyl]butoxy]-4-oxobutanoic acid (PubChem CID 59918345) has the molecular formula C33H53N3O9 and a molecular weight of 635.80 g/mol. Its IUPAC name is 4-[2-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxymethyl]-2-[(4-methylcyclohexyl)carbamoyloxymethyl]butoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxymethyl]-2-[(4-methylcyclohexyl)carbamoyloxymethyl]butoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59918345 |
| Molecular Formula | C33H53N3O9 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.38 |
| IUPAC Name | 4-[2-[[4-[(4-isocyanatocyclohexyl)methyl]cyclohexyl]carbamoyloxymethyl]-2-[(4-methylcyclohexyl)carbamoyloxymethyl]butoxy]-4-oxobutanoic acid |
| SMILES | CCC(COC(=O)CCC(=O)O)(COC(=O)NC1CCC(C)CC1)COC(=O)NC1CCC(CC2CCC(N=C=O)CC2)CC1 |
| InChI | InChI=1S/C33H53N3O9/c1-3-33(19-43-30(40)17-16-29(38)39,20-44-31(41)35-27-10-4-23(2)5-11-27)21-45-32(42)36-28-14-8-25(9-15-28)18-24-6-12-26(13-7-24)34-22-37/h23-28H,3-21H2,1-2H3,(H,35,41)(H,36,42)(H,38,39) |
| InChIKey | XJVNGGZAAYHZMZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 169.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|