C33H70O4Si3 — CID 59921888
(3S,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethylundec-10-en-5-one (PubChem CID 59921888) has the molecular formula C33H70O4Si3 and a molecular weight of 615.18 g/mol. Its IUPAC name is (3S,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethylundec-10-en-5-one.
| Compound Name | (3S,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethylundec-10-en-5-one |
|---|---|
| PubChem CID | 59921888 |
| Molecular Formula | C33H70O4Si3 |
| Molecular Weight | 615.18 g/mol |
| Exact Mass | 614.46 |
| IUPAC Name | (3S,7S,8S)-1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethylundec-10-en-5-one |
| SMILES | C=CC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H70O4Si3/c1-21-22-25(2)28(37-40(19,20)32(10,11)12)26(3)29(34)33(13,14)27(36-39(17,18)31(7,8)9)23-24-35-38(15,16)30(4,5)6/h21,25-28H,1,22-24H2,2-20H3/t25-,26?,27-,28-/m0/s1 |
| InChIKey | LHSOEAFFHMOSJL-ZXTYARETSA-N |
| XLogP | 10.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.18 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|