C8H13N3 — CID 59929931
1,3,9-triazaspiro[5.5]undeca-1,3-diene (PubChem CID 59929931) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,3,9-triazaspiro[5.5]undeca-1,3-diene.
| Compound Name | 1,3,9-triazaspiro[5.5]undeca-1,3-diene |
|---|---|
| PubChem CID | 59929931 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1,3,9-triazaspiro[5.5]undeca-1,3-diene |
| SMILES | C1=NC=NC2(C1)CCNCC2 |
| InChI | InChI=1S/C8H13N3/c1-4-9-5-2-8(1)3-6-10-7-11-8/h6-7,9H,1-5H2 |
| InChIKey | ZFAFLZRMCJIHKS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |