C29H35NO6 — CID 59935357
3-[4-[4-[3-(oxetan-3-yloxy)propyl]-N-(prop-2-enoyloxymethyl)anilino]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 59935357) has the molecular formula C29H35NO6 and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-[4-[4-[3-(oxetan-3-yloxy)propyl]-N-(prop-2-enoyloxymethyl)anilino]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[4-[3-(oxetan-3-yloxy)propyl]-N-(prop-2-enoyloxymethyl)anilino]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59935357 |
| Molecular Formula | C29H35NO6 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 3-[4-[4-[3-(oxetan-3-yloxy)propyl]-N-(prop-2-enoyloxymethyl)anilino]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCN(c1ccc(CCCOC(=O)C(=C)C)cc1)c1ccc(CCCOC2COC2)cc1 |
| InChI | InChI=1S/C29H35NO6/c1-4-28(31)36-21-30(25-13-9-23(10-14-25)7-5-17-34-27-19-33-20-27)26-15-11-24(12-16-26)8-6-18-35-29(32)22(2)3/h4,9-16,27H,1-2,5-8,17-21H2,3H3 |
| InChIKey | PEUCHFYOPJIVDF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|