C27H26Cl2N6O8 — CID 59947710
(10S)-2-benzamido-N-[(2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-4,4-dihydroxy-1-oxobutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 59947710) has the molecular formula C27H26Cl2N6O8 and a molecular weight of 633.45 g/mol. Its IUPAC name is (10S)-2-benzamido-N-[(2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-4,4-dihydroxy-1-oxobutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | (10S)-2-benzamido-N-[(2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-4,4-dihydroxy-1-oxobutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 59947710 |
| Molecular Formula | C27H26Cl2N6O8 |
| Molecular Weight | 633.45 g/mol |
| Exact Mass | 632.12 |
| IUPAC Name | (10S)-2-benzamido-N-[(2S)-1-(5,7-dichloro-1,3-benzoxazol-2-yl)-4,4-dihydroxy-1-oxobutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | O=C(NN1CCC(=O)N2CCC[C@@H](C(=O)N[C@@H](CC(O)O)C(=O)c3nc4cc(Cl)cc(Cl)c4o3)N2C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H26Cl2N6O8/c28-15-11-16(29)23-18(12-15)31-26(43-23)22(39)17(13-21(37)38)30-25(41)19-7-4-9-34-20(36)8-10-33(27(42)35(19)34)32-24(40)14-5-2-1-3-6-14/h1-3,5-6,11-12,17,19,21,37-38H,4,7-10,13H2,(H,30,41)(H,32,40)/t17-,19-/m0/s1 |
| InChIKey | KOYLNCNGHXELPB-HKUYNNGSSA-N |
| XLogP | 1.88 |
| TPSA | 185.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|