C27H30Cl2N6O7 — CID 90794720
(10S)-2-benzamido-N-[(2S)-1-[(2,6-dichlorophenyl)methoxyimino]-4,4-dihydroxybutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide (PubChem CID 90794720) has the molecular formula C27H30Cl2N6O7 and a molecular weight of 621.48 g/mol. Its IUPAC name is (10S)-2-benzamido-N-[(2S)-1-[(2,6-dichlorophenyl)methoxyimino]-4,4-dihydroxybutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide.
| Compound Name | (10S)-2-benzamido-N-[(2S)-1-[(2,6-dichlorophenyl)methoxyimino]-4,4-dihydroxybutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
|---|---|
| PubChem CID | 90794720 |
| Molecular Formula | C27H30Cl2N6O7 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | (10S)-2-benzamido-N-[(2S)-1-[(2,6-dichlorophenyl)methoxyimino]-4,4-dihydroxybutan-2-yl]-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carboxamide |
| SMILES | O=C(NN1CCC(=O)N2CCC[C@@H](C(=O)N[C@H](C=NOCc3c(Cl)cccc3Cl)CC(O)O)N2C1=O)c1ccccc1 |
| InChI | InChI=1S/C27H30Cl2N6O7/c28-20-8-4-9-21(29)19(20)16-42-30-15-18(14-24(37)38)31-26(40)22-10-5-12-34-23(36)11-13-33(27(41)35(22)34)32-25(39)17-6-2-1-3-7-17/h1-4,6-9,15,18,22,24,37-38H,5,10-14,16H2,(H,31,40)(H,32,39)/t18-,22-/m0/s1 |
| InChIKey | XSTOCWRLLHEOAN-AVRDEDQJSA-N |
| XLogP | 2.06 |
| TPSA | 164.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|