C27H28Cl2N6O7 — CID 74007864
3-[(2-benzamido-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl)amino]-4-[(2,6-dichlorophenyl)methoxyimino]butanoic acid (PubChem CID 74007864) has the molecular formula C27H28Cl2N6O7 and a molecular weight of 619.46 g/mol. Its IUPAC name is 3-[(2-benzamido-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl)amino]-4-[(2,6-dichlorophenyl)methoxyimino]butanoic acid.
| Compound Name | 3-[(2-benzamido-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl)amino]-4-[(2,6-dichlorophenyl)methoxyimino]butanoic acid |
|---|---|
| PubChem CID | 74007864 |
| Molecular Formula | C27H28Cl2N6O7 |
| Molecular Weight | 619.46 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | 3-[(2-benzamido-1,5-dioxo-3,4,7,8,9,10-hexahydropyridazino[1,2-a][1,2,4]triazepine-10-carbonyl)amino]-4-[(2,6-dichlorophenyl)methoxyimino]butanoic acid |
| SMILES | O=C(O)CC(C=NOCc1c(Cl)cccc1Cl)NC(=O)C1CCCN2C(=O)CCN(NC(=O)c3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C27H28Cl2N6O7/c28-20-8-4-9-21(29)19(20)16-42-30-15-18(14-24(37)38)31-26(40)22-10-5-12-34-23(36)11-13-33(27(41)35(22)34)32-25(39)17-6-2-1-3-7-17/h1-4,6-9,15,18,22H,5,10-14,16H2,(H,31,40)(H,32,39)(H,37,38) |
| InChIKey | FUXCRBWPELMUOB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 160.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|