C25H14O6S2 — CID 59952284
(2Z)-2-[(1-hydroxy-3,3-dioxobenzo[e][1]benzothiol-2-yl)methylidene]-3,3-dioxobenzo[e][1]benzothiol-1-one (PubChem CID 59952284) has the molecular formula C25H14O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2Z)-2-[(1-hydroxy-3,3-dioxobenzo[e][1]benzothiol-2-yl)methylidene]-3,3-dioxobenzo[e][1]benzothiol-1-one.
| Compound Name | (2Z)-2-[(1-hydroxy-3,3-dioxobenzo[e][1]benzothiol-2-yl)methylidene]-3,3-dioxobenzo[e][1]benzothiol-1-one |
|---|---|
| PubChem CID | 59952284 |
| Molecular Formula | C25H14O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | (2Z)-2-[(1-hydroxy-3,3-dioxobenzo[e][1]benzothiol-2-yl)methylidene]-3,3-dioxobenzo[e][1]benzothiol-1-one |
| SMILES | O=C1/C(=C/C2=C(O)c3c(ccc4ccccc34)S2(=O)=O)S(=O)(=O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C25H14O6S2/c26-24-20(32(28,29)18-11-9-14-5-1-3-7-16(14)22(18)24)13-21-25(27)23-17-8-4-2-6-15(17)10-12-19(23)33(21,30)31/h1-13,26H/b21-13- |
| InChIKey | CHGQVFZIQNSFJE-BKUYFWCQSA-N |
| XLogP | 4.56 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|