C19H16O3 — CID 68600365
1-hydroxy-2-(2-methylbut-3-en-2-yl)phenanthrene-3,4-dione (PubChem CID 68600365) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-hydroxy-2-(2-methylbut-3-en-2-yl)phenanthrene-3,4-dione.
| Compound Name | 1-hydroxy-2-(2-methylbut-3-en-2-yl)phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 68600365 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-hydroxy-2-(2-methylbut-3-en-2-yl)phenanthrene-3,4-dione |
| SMILES | C=CC(C)(C)C1=C(O)c2ccc3ccccc3c2C(=O)C1=O |
| InChI | InChI=1S/C19H16O3/c1-4-19(2,3)15-16(20)13-10-9-11-7-5-6-8-12(11)14(13)17(21)18(15)22/h4-10,20H,1H2,2-3H3 |
| InChIKey | ZXGLZYGRAFSVLM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|