C9H11NY-2 — CID 59955275
4-buta-1,3-dienyl-1,2,3,6-tetrahydropyridine;yttrium (PubChem CID 59955275) has the molecular formula C9H11NY-2 and a molecular weight of 222.10 g/mol. Its IUPAC name is 4-buta-1,3-dienyl-1,2,3,6-tetrahydropyridine;yttrium.
| Compound Name | 4-buta-1,3-dienyl-1,2,3,6-tetrahydropyridine;yttrium |
|---|---|
| PubChem CID | 59955275 |
| Molecular Formula | C9H11NY-2 |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4-buta-1,3-dienyl-1,2,3,6-tetrahydropyridine;yttrium |
| SMILES | [H]/[C-]=C/C=[C-]/C1=CCNCC1.[Y] |
| InChI | InChI=1S/C9H11N.Y/c1-2-3-4-9-5-7-10-8-6-9;/h1-3,5,10H,6-8H2;/q-2; |
| InChIKey | IENHTKBKYLNJIF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|