C22H26N2O4S — CID 59955288
N-[4-[(5S)-5-hydroxy-6-(1H-pyrrol-3-yloxy)hexyl]phenyl]benzenesulfonamide (PubChem CID 59955288) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[4-[(5S)-5-hydroxy-6-(1H-pyrrol-3-yloxy)hexyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[(5S)-5-hydroxy-6-(1H-pyrrol-3-yloxy)hexyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59955288 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[4-[(5S)-5-hydroxy-6-(1H-pyrrol-3-yloxy)hexyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCCC[C@H](O)COc2cc[nH]c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4S/c25-20(17-28-21-14-15-23-16-21)7-5-4-6-18-10-12-19(13-11-18)24-29(26,27)22-8-2-1-3-9-22/h1-3,8-16,20,23-25H,4-7,17H2/t20-/m0/s1 |
| InChIKey | LVZJTUZZQGXSEF-FQEVSTJZSA-N |
| XLogP | 3.97 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|