C23H29NO2 — CID 59963132
5-(hydroperoxymethyl)-2-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine (PubChem CID 59963132) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 5-(hydroperoxymethyl)-2-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine.
| Compound Name | 5-(hydroperoxymethyl)-2-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine |
|---|---|
| PubChem CID | 59963132 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 5-(hydroperoxymethyl)-2-[(Z)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-en-2-yl]pyridine |
| SMILES | C/C(=C/c1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccc(COO)cn1 |
| InChI | InChI=1S/C23H29NO2/c1-16(21-9-7-18(14-24-21)15-26-25)12-17-6-8-19-20(13-17)23(4,5)11-10-22(19,2)3/h6-9,12-14,25H,10-11,15H2,1-5H3/b16-12- |
| InChIKey | UYGYGMTVQUGJMH-VBKFSLOCSA-N |
| XLogP | 5.98 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|